Environmental protection ammonia spray denitrification equipment with low maintenance costs for ammonia desulfurization and denitrification equipment in the later stage

Ammonia desulfurization and denitrification equipment is currently used for desulfurization and denitrification in furnaceseffectiveTechnologies for controlling sulfur dioxide emissionsone ofMany people refer to it as ammonia spray denitrification equipment,The environmentally friendly ammonia spray desulfurization and denitrification equipmentNot only canenoughRemove sulfur dioxide from flue gas, andAnd alsoCapable of producing high value-added ammonium sulfate fertilizer products.Environmental protection ammonia spray denitrification equipmentThe process system of ammonia flue gas desulfurization and denitrification equipment consists of an absorbent storage and addition system, a concentration absorption system, an oxidation air system, a process water system, a by-product recovery and storage system, and an automatic control system. The desulfurization and denitrification equipment is a new type of desulfurization tower that adopts an integrated design of dust removal and cooling, pre washing, desulfurization, absorption liquid concentration, ammonium sulfite oxidation, and flue gas defogging and emission. The absorption tower body is made of steel lined glass flake anti-corrosion material.

The chemical reaction equation of heavy ammonia gas in the ammonia spray denitrification equipment during the countercurrent contact and washing process between flue gas and desulfurization slurry is as follows:

1. SO2 absorption reaction:

SO2+ 2NH3+H2O=(NH4)2SO3

SO2+(NH4)2SO3+H2O=2NH4HSO3

NH3+NH4HSO3=(NH4)2SO3

2. Oxidation reaction

2(NH4)2SO3+O2=2(NH4)2SO4

The desulfurization absorption tower equipment involved in the reaction is designed as a countercurrent spray absorption tower. The bottom of the desulfurization tower is an oxidation tank, and three layers of circulating spray layers are arranged on the top. The flue gas generated by the boiler flows through the spray absorption zone from bottom to top, and is discharged from the absorption tower after being washed, desulfurized, and defoggered.